About 1,4-dimethylpiperidin-4-ol;4-methylpiperidin-4-ol;1-methylpiperidin-4-one
1,4-dimethylpiperidin-4-ol;4-methylpiperidin-4-ol;1-methylpiperidin-4-one (PubChem CID 159017254) has the molecular formula C19H39N3O3
and a molecular weight of 357.54 g/mol. Its IUPAC name is 1,4-dimethylpiperidin-4-ol;4-methylpiperidin-4-ol;1-methylpiperidin-4-one.
Molecular Properties
| Compound Name | 1,4-dimethylpiperidin-4-ol;4-methylpiperidin-4-ol;1-methylpiperidin-4-one |
| PubChem CID | 159017254 |
| Molecular Formula | C19H39N3O3 |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.30 |
| IUPAC Name | 1,4-dimethylpiperidin-4-ol;4-methylpiperidin-4-ol;1-methylpiperidin-4-one |
| SMILES | CC1(O)CCNCC1.CN1CCC(=O)CC1.CN1CCC(C)(O)CC1 |
| InChI | InChI=1S/C7H15NO.C6H11NO.C6H13NO/c1-7(9)3-5-8(2)6-4-7;1-7-4-2-6(8)3-5-7;1-6(8)2-4-7-5-3-6/h9H,3-6H2,1-2H3;2-5H2,1H3;7-8H,2-5H2,1H3 |
| InChIKey | JTGCBAOMAWHXFB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,4-dimethylpiperidin-4-ol;4-methylpiperidin-4-ol;1-methylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylpiperidin-4-ol;4-methylpiperidin-4-ol;1-methylpiperidin-4-one?
The IUPAC name of 1,4-dimethylpiperidin-4-ol;4-methylpiperidin-4-ol;1-methylpiperidin-4-one (CID 159017254) is 1,4-dimethylpiperidin-4-ol;4-methylpiperidin-4-ol;1-methylpiperidin-4-one.
What is the SMILES notation for 1,4-dimethylpiperidin-4-ol;4-methylpiperidin-4-ol;1-methylpiperidin-4-one?
The canonical SMILES for 1,4-dimethylpiperidin-4-ol;4-methylpiperidin-4-ol;1-methylpiperidin-4-one is CC1(O)CCNCC1.CN1CCC(=O)CC1.CN1CCC(C)(O)CC1.
What is the InChIKey of 1,4-dimethylpiperidin-4-ol;4-methylpiperidin-4-ol;1-methylpiperidin-4-one?
The InChIKey is JTGCBAOMAWHXFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.C6H11NO.C6H13NO/c1-7(9)3-5-8(2)6-4-7;1-7-4-2-6(8)3-5-7;1-6(8)2-4-7-5-3-6/h9H,3-6H2,1-2H3;2-5H2,1H3;7-8H,2-5H2,1H3.
What are the key properties of 1,4-dimethylpiperidin-4-ol;4-methylpiperidin-4-ol;1-methylpiperidin-4-one?
1,4-dimethylpiperidin-4-ol;4-methylpiperidin-4-ol;1-methylpiperidin-4-one has a molecular weight of 357.54 g/mol, XLogP of 0.86, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylpiperidin-4-ol;4-methylpiperidin-4-ol;1-methylpiperidin-4-one is sourced from PubChem (CID 159017254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).