About 1,3-dimethylpiperidin-4-one;1-methylpiperidin-4-one;3-methylpiperidin-4-one
1,3-dimethylpiperidin-4-one;1-methylpiperidin-4-one;3-methylpiperidin-4-one (PubChem CID 159347195) has the molecular formula C19H35N3O3
and a molecular weight of 353.51 g/mol. Its IUPAC name is 1,3-dimethylpiperidin-4-one;1-methylpiperidin-4-one;3-methylpiperidin-4-one.
Molecular Properties
| Compound Name | 1,3-dimethylpiperidin-4-one;1-methylpiperidin-4-one;3-methylpiperidin-4-one |
| PubChem CID | 159347195 |
| Molecular Formula | C19H35N3O3 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | 1,3-dimethylpiperidin-4-one;1-methylpiperidin-4-one;3-methylpiperidin-4-one |
| SMILES | CC1CN(C)CCC1=O.CC1CNCCC1=O.CN1CCC(=O)CC1 |
| InChI | InChI=1S/C7H13NO.2C6H11NO/c1-6-5-8(2)4-3-7(6)9;1-7-4-2-6(8)3-5-7;1-5-4-7-3-2-6(5)8/h6H,3-5H2,1-2H3;2-5H2,1H3;5,7H,2-4H2,1H3 |
| InChIKey | LGWIHHFOSJOWLN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,3-dimethylpiperidin-4-one;1-methylpiperidin-4-one;3-methylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpiperidin-4-one;1-methylpiperidin-4-one;3-methylpiperidin-4-one?
The IUPAC name of 1,3-dimethylpiperidin-4-one;1-methylpiperidin-4-one;3-methylpiperidin-4-one (CID 159347195) is 1,3-dimethylpiperidin-4-one;1-methylpiperidin-4-one;3-methylpiperidin-4-one.
What is the SMILES notation for 1,3-dimethylpiperidin-4-one;1-methylpiperidin-4-one;3-methylpiperidin-4-one?
The canonical SMILES for 1,3-dimethylpiperidin-4-one;1-methylpiperidin-4-one;3-methylpiperidin-4-one is CC1CN(C)CCC1=O.CC1CNCCC1=O.CN1CCC(=O)CC1.
What is the InChIKey of 1,3-dimethylpiperidin-4-one;1-methylpiperidin-4-one;3-methylpiperidin-4-one?
The InChIKey is LGWIHHFOSJOWLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.2C6H11NO/c1-6-5-8(2)4-3-7(6)9;1-7-4-2-6(8)3-5-7;1-5-4-7-3-2-6(5)8/h6H,3-5H2,1-2H3;2-5H2,1H3;5,7H,2-4H2,1H3.
What are the key properties of 1,3-dimethylpiperidin-4-one;1-methylpiperidin-4-one;3-methylpiperidin-4-one?
1,3-dimethylpiperidin-4-one;1-methylpiperidin-4-one;3-methylpiperidin-4-one has a molecular weight of 353.51 g/mol, XLogP of 0.99, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpiperidin-4-one;1-methylpiperidin-4-one;3-methylpiperidin-4-one is sourced from PubChem (CID 159347195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).