C25H25NO — CID 159017435
1-ethenyl-4-(methoxymethyl)benzene;3-ethenyl-9-methylcarbazole (PubChem CID 159017435) has the molecular formula C25H25NO and a molecular weight of 355.48 g/mol. Its IUPAC name is 1-ethenyl-4-(methoxymethyl)benzene;3-ethenyl-9-methylcarbazole.
| Compound Name | 1-ethenyl-4-(methoxymethyl)benzene;3-ethenyl-9-methylcarbazole |
|---|---|
| PubChem CID | 159017435 |
| Molecular Formula | C25H25NO |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 1-ethenyl-4-(methoxymethyl)benzene;3-ethenyl-9-methylcarbazole |
| SMILES | C=Cc1ccc(COC)cc1.C=Cc1ccc2c(c1)c1ccccc1n2C |
| InChI | InChI=1S/C15H13N.C10H12O/c1-3-11-8-9-15-13(10-11)12-6-4-5-7-14(12)16(15)2;1-3-9-4-6-10(7-5-9)8-11-2/h3-10H,1H2,2H3;3-7H,1,8H2,2H3 |
| InChIKey | JTGQEGFADUDVPM-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |