About tris(dimethylazanide);1H-inden-1-ide;zirconium(4+)
tris(dimethylazanide);1H-inden-1-ide;zirconium(4+) (PubChem CID 15902074) has the molecular formula C15H25N3Zr
and a molecular weight of 338.61 g/mol. Its IUPAC name is tris(dimethylazanide);1H-inden-1-ide;zirconium(4+).
Molecular Properties
| Compound Name | tris(dimethylazanide);1H-inden-1-ide;zirconium(4+) |
| PubChem CID | 15902074 |
| Molecular Formula | C15H25N3Zr |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | tris(dimethylazanide);1H-inden-1-ide;zirconium(4+) |
| SMILES | C[N-]C.C[N-]C.C[N-]C.[Zr+4].c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C9H7.3C2H6N.Zr/c1-2-5-9-7-3-6-8(9)4-1;3*1-3-2;/h1-7H;3*1-2H3;/q4*-1;+4 |
| InChIKey | XQUUQSNWURSZJN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 42.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze tris(dimethylazanide);1H-inden-1-ide;zirconium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(dimethylazanide);1H-inden-1-ide;zirconium(4+)?
The IUPAC name of tris(dimethylazanide);1H-inden-1-ide;zirconium(4+) (CID 15902074) is tris(dimethylazanide);1H-inden-1-ide;zirconium(4+).
What is the SMILES notation for tris(dimethylazanide);1H-inden-1-ide;zirconium(4+)?
The canonical SMILES for tris(dimethylazanide);1H-inden-1-ide;zirconium(4+) is C[N-]C.C[N-]C.C[N-]C.[Zr+4].c1ccc2[cH-]ccc2c1.
What is the InChIKey of tris(dimethylazanide);1H-inden-1-ide;zirconium(4+)?
The InChIKey is XQUUQSNWURSZJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7.3C2H6N.Zr/c1-2-5-9-7-3-6-8(9)4-1;3*1-3-2;/h1-7H;3*1-2H3;/q4*-1;+4.
What are the key properties of tris(dimethylazanide);1H-inden-1-ide;zirconium(4+)?
tris(dimethylazanide);1H-inden-1-ide;zirconium(4+) has a molecular weight of 338.61 g/mol, XLogP of 4.42, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tris(dimethylazanide);1H-inden-1-ide;zirconium(4+) is sourced from PubChem (CID 15902074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).