C25H26N4O3 — CID 159027962
ethyl 2-[4-[2-(4-ethylanilino)-1-methylbenzimidazol-5-yl]oxy-2-pyridinyl]acetate (PubChem CID 159027962) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is ethyl 2-[4-[2-(4-ethylanilino)-1-methylbenzimidazol-5-yl]oxy-2-pyridinyl]acetate.
| Compound Name | ethyl 2-[4-[2-(4-ethylanilino)-1-methylbenzimidazol-5-yl]oxy-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 159027962 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | ethyl 2-[4-[2-(4-ethylanilino)-1-methylbenzimidazol-5-yl]oxy-2-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1cc(Oc2ccc3c(c2)nc(Nc2ccc(CC)cc2)n3C)ccn1 |
| InChI | InChI=1S/C25H26N4O3/c1-4-17-6-8-18(9-7-17)27-25-28-22-16-20(10-11-23(22)29(25)3)32-21-12-13-26-19(14-21)15-24(30)31-5-2/h6-14,16H,4-5,15H2,1-3H3,(H,27,28) |
| InChIKey | JUMZOGOERNXGEF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |