C20H38O4S2 — CID 159028001
13-methyl-1-(2-propan-2-ylsulfonylethylsulfanyl)tetradecane-4,10-dione (PubChem CID 159028001) has the molecular formula C20H38O4S2 and a molecular weight of 406.65 g/mol. Its IUPAC name is 13-methyl-1-(2-propan-2-ylsulfonylethylsulfanyl)tetradecane-4,10-dione.
| Compound Name | 13-methyl-1-(2-propan-2-ylsulfonylethylsulfanyl)tetradecane-4,10-dione |
|---|---|
| PubChem CID | 159028001 |
| Molecular Formula | C20H38O4S2 |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 13-methyl-1-(2-propan-2-ylsulfonylethylsulfanyl)tetradecane-4,10-dione |
| SMILES | CC(C)CCC(=O)CCCCCC(=O)CCCSCCS(=O)(=O)C(C)C |
| InChI | InChI=1S/C20H38O4S2/c1-17(2)12-13-20(22)10-7-5-6-9-19(21)11-8-14-25-15-16-26(23,24)18(3)4/h17-18H,5-16H2,1-4H3 |
| InChIKey | NYWCCXXJIQVMQM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|