C34H22F2N8O6 — CID 159028022
4-[(4-fluoro-3-isocyanatophenyl)methyl]-2H-phthalazin-1-one;1-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 159028022) has the molecular formula C34H22F2N8O6 and a molecular weight of 676.60 g/mol. Its IUPAC name is 4-[(4-fluoro-3-isocyanatophenyl)methyl]-2H-phthalazin-1-one;1-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 4-[(4-fluoro-3-isocyanatophenyl)methyl]-2H-phthalazin-1-one;1-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 159028022 |
| Molecular Formula | C34H22F2N8O6 |
| Molecular Weight | 676.60 g/mol |
| Exact Mass | 676.16 |
| IUPAC Name | 4-[(4-fluoro-3-isocyanatophenyl)methyl]-2H-phthalazin-1-one;1-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=C=Nc1cc(Cc2n[nH]c(=O)c3ccccc23)ccc1F.O=c1[nH]c(=O)n(-c2cc(Cc3n[nH]c(=O)c4ccccc34)ccc2F)c(=O)[nH]1 |
| InChI | InChI=1S/C18H12FN5O4.C16H10FN3O2/c19-12-6-5-9(8-14(12)24-17(27)20-16(26)21-18(24)28)7-13-10-3-1-2-4-11(10)15(25)23-22-13;17-13-6-5-10(8-15(13)18-9-21)7-14-11-3-1-2-4-12(11)16(22)20-19-14/h1-6,8H,7H2,(H,23,25)(H2,20,21,26,27,28);1-6,8H,7H2,(H,20,22) |
| InChIKey | JUNFHMRGMHZDJX-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 208.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.60 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|