C35H39BBr2N2O2 — CID 159028749
6-bromo-1-ethylindole;6-bromo-1H-indene;1-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole (PubChem CID 159028749) has the molecular formula C35H39BBr2N2O2 and a molecular weight of 690.33 g/mol. Its IUPAC name is 6-bromo-1-ethylindole;6-bromo-1H-indene;1-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole.
| Compound Name | 6-bromo-1-ethylindole;6-bromo-1H-indene;1-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
|---|---|
| PubChem CID | 159028749 |
| Molecular Formula | C35H39BBr2N2O2 |
| Molecular Weight | 690.33 g/mol |
| Exact Mass | 688.15 |
| IUPAC Name | 6-bromo-1-ethylindole;6-bromo-1H-indene;1-ethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole |
| SMILES | Brc1ccc2c(c1)CC=C2.CCn1ccc2ccc(B3OC(C)(C)C(C)(C)O3)cc21.CCn1ccc2ccc(Br)cc21 |
| InChI | InChI=1S/C16H22BNO2.C10H10BrN.C9H7Br/c1-6-18-10-9-12-7-8-13(11-14(12)18)17-19-15(2,3)16(4,5)20-17;1-2-12-6-5-8-3-4-9(11)7-10(8)12;10-9-5-4-7-2-1-3-8(7)6-9/h7-11H,6H2,1-5H3;3-7H,2H2,1H3;1-2,4-6H,3H2 |
| InChIKey | JUPKBOZTBKMRTI-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 28.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.33 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|