C28H27N5O4 — CID 159029436
(E)-1-(6-amino-3-pyridinyl)-5-[7-methyl-5-[5-(morpholine-4-carbonyl)pyrimidin-2-yl]-1-benzofuran-2-yl]pent-1-en-3-one (PubChem CID 159029436) has the molecular formula C28H27N5O4 and a molecular weight of 497.56 g/mol. Its IUPAC name is (E)-1-(6-amino-3-pyridinyl)-5-[7-methyl-5-[5-(morpholine-4-carbonyl)pyrimidin-2-yl]-1-benzofuran-2-yl]pent-1-en-3-one.
| Compound Name | (E)-1-(6-amino-3-pyridinyl)-5-[7-methyl-5-[5-(morpholine-4-carbonyl)pyrimidin-2-yl]-1-benzofuran-2-yl]pent-1-en-3-one |
|---|---|
| PubChem CID | 159029436 |
| Molecular Formula | C28H27N5O4 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | (E)-1-(6-amino-3-pyridinyl)-5-[7-methyl-5-[5-(morpholine-4-carbonyl)pyrimidin-2-yl]-1-benzofuran-2-yl]pent-1-en-3-one |
| SMILES | Cc1cc(-c2ncc(C(=O)N3CCOCC3)cn2)cc2cc(CCC(=O)/C=C/c3ccc(N)nc3)oc12 |
| InChI | InChI=1S/C28H27N5O4/c1-18-12-21(27-31-16-22(17-32-27)28(35)33-8-10-36-11-9-33)13-20-14-24(37-26(18)20)6-5-23(34)4-2-19-3-7-25(29)30-15-19/h2-4,7,12-17H,5-6,8-11H2,1H3,(H2,29,30)/b4-2+ |
| InChIKey | WLJIOHALUJTQGY-DUXPYHPUSA-N |
| XLogP | 3.86 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|