C30H29N3O5 — CID 158468243
(E)-1-(6-amino-3-pyridinyl)-5-[7-methoxy-5-[4-(morpholine-4-carbonyl)phenyl]-1-benzofuran-2-yl]pent-1-en-3-one (PubChem CID 158468243) has the molecular formula C30H29N3O5 and a molecular weight of 511.58 g/mol. Its IUPAC name is (E)-1-(6-amino-3-pyridinyl)-5-[7-methoxy-5-[4-(morpholine-4-carbonyl)phenyl]-1-benzofuran-2-yl]pent-1-en-3-one.
| Compound Name | (E)-1-(6-amino-3-pyridinyl)-5-[7-methoxy-5-[4-(morpholine-4-carbonyl)phenyl]-1-benzofuran-2-yl]pent-1-en-3-one |
|---|---|
| PubChem CID | 158468243 |
| Molecular Formula | C30H29N3O5 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | (E)-1-(6-amino-3-pyridinyl)-5-[7-methoxy-5-[4-(morpholine-4-carbonyl)phenyl]-1-benzofuran-2-yl]pent-1-en-3-one |
| SMILES | COc1cc(-c2ccc(C(=O)N3CCOCC3)cc2)cc2cc(CCC(=O)/C=C/c3ccc(N)nc3)oc12 |
| InChI | InChI=1S/C30H29N3O5/c1-36-27-18-23(21-4-6-22(7-5-21)30(35)33-12-14-37-15-13-33)16-24-17-26(38-29(24)27)10-9-25(34)8-2-20-3-11-28(31)32-19-20/h2-8,11,16-19H,9-10,12-15H2,1H3,(H2,31,32)/b8-2+ |
| InChIKey | KKBPMOYWLASPFO-KRXBUXKQSA-N |
| XLogP | 4.77 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|