C29H25ClN2O4 — CID 147093811
(E)-5-[7-chloro-5-[4-(morpholine-4-carbonyl)phenyl]-1-benzofuran-2-yl]-1-pyridin-2-ylpent-1-en-3-one (PubChem CID 147093811) has the molecular formula C29H25ClN2O4 and a molecular weight of 500.98 g/mol. Its IUPAC name is (E)-5-[7-chloro-5-[4-(morpholine-4-carbonyl)phenyl]-1-benzofuran-2-yl]-1-pyridin-2-ylpent-1-en-3-one.
| Compound Name | (E)-5-[7-chloro-5-[4-(morpholine-4-carbonyl)phenyl]-1-benzofuran-2-yl]-1-pyridin-2-ylpent-1-en-3-one |
|---|---|
| PubChem CID | 147093811 |
| Molecular Formula | C29H25ClN2O4 |
| Molecular Weight | 500.98 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | (E)-5-[7-chloro-5-[4-(morpholine-4-carbonyl)phenyl]-1-benzofuran-2-yl]-1-pyridin-2-ylpent-1-en-3-one |
| SMILES | O=C(/C=C/c1ccccn1)CCc1cc2cc(-c3ccc(C(=O)N4CCOCC4)cc3)cc(Cl)c2o1 |
| InChI | InChI=1S/C29H25ClN2O4/c30-27-19-22(20-4-6-21(7-5-20)29(34)32-13-15-35-16-14-32)17-23-18-26(36-28(23)27)11-10-25(33)9-8-24-3-1-2-12-31-24/h1-9,12,17-19H,10-11,13-16H2/b9-8+ |
| InChIKey | BJICJHKKFGDBAO-CMDGGOBGSA-N |
| XLogP | 5.84 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.98 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|