C23H30N4O10 — CID 159029976
2-(4-acetamidophenoxy)ethyl nitrate;5-(4-acetamidophenoxy)pentyl nitrate (PubChem CID 159029976) has the molecular formula C23H30N4O10 and a molecular weight of 522.51 g/mol. Its IUPAC name is 2-(4-acetamidophenoxy)ethyl nitrate;5-(4-acetamidophenoxy)pentyl nitrate.
| Compound Name | 2-(4-acetamidophenoxy)ethyl nitrate;5-(4-acetamidophenoxy)pentyl nitrate |
|---|---|
| PubChem CID | 159029976 |
| Molecular Formula | C23H30N4O10 |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 2-(4-acetamidophenoxy)ethyl nitrate;5-(4-acetamidophenoxy)pentyl nitrate |
| SMILES | CC(=O)Nc1ccc(OCCCCCO[N+](=O)[O-])cc1.CC(=O)Nc1ccc(OCCO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H18N2O5.C10H12N2O5/c1-11(16)14-12-5-7-13(8-6-12)19-9-3-2-4-10-20-15(17)18;1-8(13)11-9-2-4-10(5-3-9)16-6-7-17-12(14)15/h5-8H,2-4,9-10H2,1H3,(H,14,16);2-5H,6-7H2,1H3,(H,11,13) |
| InChIKey | JUTKHDVRZOJDNO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 181.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|