About 2-[4-(2-nitrooxyethoxy)phenoxy]ethyl 2-oxopropanoate
2-[4-(2-nitrooxyethoxy)phenoxy]ethyl 2-oxopropanoate (PubChem CID 11220712) has the molecular formula C13H15NO8
and a molecular weight of 313.26 g/mol. Its IUPAC name is 2-[4-(2-nitrooxyethoxy)phenoxy]ethyl 2-oxopropanoate.
Molecular Properties
| Compound Name | 2-[4-(2-nitrooxyethoxy)phenoxy]ethyl 2-oxopropanoate |
| PubChem CID | 11220712 |
| Molecular Formula | C13H15NO8 |
| Molecular Weight | 313.26 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 2-[4-(2-nitrooxyethoxy)phenoxy]ethyl 2-oxopropanoate |
| SMILES | CC(=O)C(=O)OCCOc1ccc(OCCO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H15NO8/c1-10(15)13(16)21-7-6-19-11-2-4-12(5-3-11)20-8-9-22-14(17)18/h2-5H,6-9H2,1H3 |
| InChIKey | LJSDMPBNQBUGHM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2-nitrooxyethoxy)phenoxy]ethyl 2-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-nitrooxyethoxy)phenoxy]ethyl 2-oxopropanoate?
The IUPAC name of 2-[4-(2-nitrooxyethoxy)phenoxy]ethyl 2-oxopropanoate (CID 11220712) is 2-[4-(2-nitrooxyethoxy)phenoxy]ethyl 2-oxopropanoate.
What is the SMILES notation for 2-[4-(2-nitrooxyethoxy)phenoxy]ethyl 2-oxopropanoate?
The canonical SMILES for 2-[4-(2-nitrooxyethoxy)phenoxy]ethyl 2-oxopropanoate is CC(=O)C(=O)OCCOc1ccc(OCCO[N+](=O)[O-])cc1.
What is the InChIKey of 2-[4-(2-nitrooxyethoxy)phenoxy]ethyl 2-oxopropanoate?
The InChIKey is LJSDMPBNQBUGHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO8/c1-10(15)13(16)21-7-6-19-11-2-4-12(5-3-11)20-8-9-22-14(17)18/h2-5H,6-9H2,1H3.
What are the key properties of 2-[4-(2-nitrooxyethoxy)phenoxy]ethyl 2-oxopropanoate?
2-[4-(2-nitrooxyethoxy)phenoxy]ethyl 2-oxopropanoate has a molecular weight of 313.26 g/mol, XLogP of 0.78, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-nitrooxyethoxy)phenoxy]ethyl 2-oxopropanoate is sourced from PubChem (CID 11220712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).