C30H34O10 — CID 21235502
2-methoxyethyl (2Z)-2-[[4-[2-[4-[(Z)-2-(2-methoxyethoxycarbonyl)-3-oxobut-1-enyl]phenoxy]ethoxy]phenyl]methylidene]-3-oxobutanoate (PubChem CID 21235502) has the molecular formula C30H34O10 and a molecular weight of 554.59 g/mol. Its IUPAC name is 2-methoxyethyl (2Z)-2-[[4-[2-[4-[(Z)-2-(2-methoxyethoxycarbonyl)-3-oxobut-1-enyl]phenoxy]ethoxy]phenyl]methylidene]-3-oxobutanoate.
| Compound Name | 2-methoxyethyl (2Z)-2-[[4-[2-[4-[(Z)-2-(2-methoxyethoxycarbonyl)-3-oxobut-1-enyl]phenoxy]ethoxy]phenyl]methylidene]-3-oxobutanoate |
|---|---|
| PubChem CID | 21235502 |
| Molecular Formula | C30H34O10 |
| Molecular Weight | 554.59 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | 2-methoxyethyl (2Z)-2-[[4-[2-[4-[(Z)-2-(2-methoxyethoxycarbonyl)-3-oxobut-1-enyl]phenoxy]ethoxy]phenyl]methylidene]-3-oxobutanoate |
| SMILES | COCCOC(=O)/C(=C\c1ccc(OCCOc2ccc(/C=C(/C(C)=O)C(=O)OCCOC)cc2)cc1)C(C)=O |
| InChI | InChI=1S/C30H34O10/c1-21(31)27(29(33)39-15-13-35-3)19-23-5-9-25(10-6-23)37-17-18-38-26-11-7-24(8-12-26)20-28(22(2)32)30(34)40-16-14-36-4/h5-12,19-20H,13-18H2,1-4H3/b27-19-,28-20- |
| InChIKey | UBRRQODWVVYHFF-RSSRHXQMSA-N |
| XLogP | 3.47 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|