C17H17NO5 — CID 76604049
2-[4-(2-isocyano-3-methoxy-3-oxoprop-1-enyl)phenoxy]ethyl 2-methylprop-2-enoate (PubChem CID 76604049) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is 2-[4-(2-isocyano-3-methoxy-3-oxoprop-1-enyl)phenoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[4-(2-isocyano-3-methoxy-3-oxoprop-1-enyl)phenoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 76604049 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-[4-(2-isocyano-3-methoxy-3-oxoprop-1-enyl)phenoxy]ethyl 2-methylprop-2-enoate |
| SMILES | [C-]#[N+]C(=Cc1ccc(OCCOC(=O)C(=C)C)cc1)C(=O)OC |
| InChI | InChI=1S/C17H17NO5/c1-12(2)16(19)23-10-9-22-14-7-5-13(6-8-14)11-15(18-3)17(20)21-4/h5-8,11H,1,9-10H2,2,4H3 |
| InChIKey | VNTOZGBBBSZEFZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|