C29H32O8 — CID 21235583
propan-2-yl (2Z)-3-oxo-2-[[4-[[4-[(Z)-3-oxo-2-propan-2-yloxycarbonylbut-1-enyl]phenoxy]methoxy]phenyl]methylidene]butanoate (PubChem CID 21235583) has the molecular formula C29H32O8 and a molecular weight of 508.57 g/mol. Its IUPAC name is propan-2-yl (2Z)-3-oxo-2-[[4-[[4-[(Z)-3-oxo-2-propan-2-yloxycarbonylbut-1-enyl]phenoxy]methoxy]phenyl]methylidene]butanoate.
| Compound Name | propan-2-yl (2Z)-3-oxo-2-[[4-[[4-[(Z)-3-oxo-2-propan-2-yloxycarbonylbut-1-enyl]phenoxy]methoxy]phenyl]methylidene]butanoate |
|---|---|
| PubChem CID | 21235583 |
| Molecular Formula | C29H32O8 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | propan-2-yl (2Z)-3-oxo-2-[[4-[[4-[(Z)-3-oxo-2-propan-2-yloxycarbonylbut-1-enyl]phenoxy]methoxy]phenyl]methylidene]butanoate |
| SMILES | CC(=O)/C(=C/c1ccc(OCOc2ccc(/C=C(/C(C)=O)C(=O)OC(C)C)cc2)cc1)C(=O)OC(C)C |
| InChI | InChI=1S/C29H32O8/c1-18(2)36-28(32)26(20(5)30)15-22-7-11-24(12-8-22)34-17-35-25-13-9-23(10-14-25)16-27(21(6)31)29(33)37-19(3)4/h7-16,18-19H,17H2,1-6H3/b26-15-,27-16- |
| InChIKey | NYURZIIDWRWFFI-FHOIBDKLSA-N |
| XLogP | 4.95 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|