C27H34N4O3S — CID 159031511
3-[[3-[3-(diethylamino)propylsulfamoyl]phenyl]methyl]-N-methyl-N-pyridin-4-ylbenzamide (PubChem CID 159031511) has the molecular formula C27H34N4O3S and a molecular weight of 494.66 g/mol. Its IUPAC name is 3-[[3-[3-(diethylamino)propylsulfamoyl]phenyl]methyl]-N-methyl-N-pyridin-4-ylbenzamide.
| Compound Name | 3-[[3-[3-(diethylamino)propylsulfamoyl]phenyl]methyl]-N-methyl-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 159031511 |
| Molecular Formula | C27H34N4O3S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 3-[[3-[3-(diethylamino)propylsulfamoyl]phenyl]methyl]-N-methyl-N-pyridin-4-ylbenzamide |
| SMILES | CCN(CC)CCCNS(=O)(=O)c1cccc(Cc2cccc(C(=O)N(C)c3ccncc3)c2)c1 |
| InChI | InChI=1S/C27H34N4O3S/c1-4-31(5-2)18-8-15-29-35(33,34)26-12-7-10-23(21-26)19-22-9-6-11-24(20-22)27(32)30(3)25-13-16-28-17-14-25/h6-7,9-14,16-17,20-21,29H,4-5,8,15,18-19H2,1-3H3 |
| InChIKey | JUYGHPLYGRSORJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|