C18H23F2NO8 — CID 159035092
(2R,4S,5R)-4-(benzylamino)-5-(carboxymethyl)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 159035092) has the molecular formula C18H23F2NO8 and a molecular weight of 419.38 g/mol. Its IUPAC name is (2R,4S,5R)-4-(benzylamino)-5-(carboxymethyl)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2R,4S,5R)-4-(benzylamino)-5-(carboxymethyl)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 159035092 |
| Molecular Formula | C18H23F2NO8 |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (2R,4S,5R)-4-(benzylamino)-5-(carboxymethyl)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | O=C(O)C[C@H]1C([C@H](O)[C@H](O)CO)O[C@@](F)(C(=O)O)C(F)[C@H]1NCc1ccccc1 |
| InChI | InChI=1S/C18H23F2NO8/c19-16-13(21-7-9-4-2-1-3-5-9)10(6-12(24)25)15(14(26)11(23)8-22)29-18(16,20)17(27)28/h1-5,10-11,13-16,21-23,26H,6-8H2,(H,24,25)(H,27,28)/t10-,11-,13+,14-,15?,16?,18-/m1/s1 |
| InChIKey | JVJBDFKEIPNBEA-YJMFNSQPSA-N |
| XLogP | -0.56 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |