About 2-fluorobenzenesulfonamide;phenylmethanol;2-phenylmethoxybenzenesulfonamide
2-fluorobenzenesulfonamide;phenylmethanol;2-phenylmethoxybenzenesulfonamide (PubChem CID 159036751) has the molecular formula C26H27FN2O6S2
and a molecular weight of 546.64 g/mol. Its IUPAC name is 2-fluorobenzenesulfonamide;phenylmethanol;2-phenylmethoxybenzenesulfonamide.
Molecular Properties
| Compound Name | 2-fluorobenzenesulfonamide;phenylmethanol;2-phenylmethoxybenzenesulfonamide |
| PubChem CID | 159036751 |
| Molecular Formula | C26H27FN2O6S2 |
| Molecular Weight | 546.64 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | 2-fluorobenzenesulfonamide;phenylmethanol;2-phenylmethoxybenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1F.NS(=O)(=O)c1ccccc1OCc1ccccc1.OCc1ccccc1 |
| InChI | InChI=1S/C13H13NO3S.C7H8O.C6H6FNO2S/c14-18(15,16)13-9-5-4-8-12(13)17-10-11-6-2-1-3-7-11;8-6-7-4-2-1-3-5-7;7-5-3-1-2-4-6(5)11(8,9)10/h1-9H,10H2,(H2,14,15,16);1-5,8H,6H2;1-4H,(H2,8,9,10) |
| InChIKey | JVNYZEODCHFOCD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 149.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 546.64 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-fluorobenzenesulfonamide;phenylmethanol;2-phenylmethoxybenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorobenzenesulfonamide;phenylmethanol;2-phenylmethoxybenzenesulfonamide?
The IUPAC name of 2-fluorobenzenesulfonamide;phenylmethanol;2-phenylmethoxybenzenesulfonamide (CID 159036751) is 2-fluorobenzenesulfonamide;phenylmethanol;2-phenylmethoxybenzenesulfonamide.
What is the SMILES notation for 2-fluorobenzenesulfonamide;phenylmethanol;2-phenylmethoxybenzenesulfonamide?
The canonical SMILES for 2-fluorobenzenesulfonamide;phenylmethanol;2-phenylmethoxybenzenesulfonamide is NS(=O)(=O)c1ccccc1F.NS(=O)(=O)c1ccccc1OCc1ccccc1.OCc1ccccc1.
What is the InChIKey of 2-fluorobenzenesulfonamide;phenylmethanol;2-phenylmethoxybenzenesulfonamide?
The InChIKey is JVNYZEODCHFOCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3S.C7H8O.C6H6FNO2S/c14-18(15,16)13-9-5-4-8-12(13)17-10-11-6-2-1-3-7-11;8-6-7-4-2-1-3-5-7;7-5-3-1-2-4-6(5)11(8,9)10/h1-9H,10H2,(H2,14,15,16);1-5,8H,6H2;1-4H,(H2,8,9,10).
What are the key properties of 2-fluorobenzenesulfonamide;phenylmethanol;2-phenylmethoxybenzenesulfonamide?
2-fluorobenzenesulfonamide;phenylmethanol;2-phenylmethoxybenzenesulfonamide has a molecular weight of 546.64 g/mol, XLogP of 3.57, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorobenzenesulfonamide;phenylmethanol;2-phenylmethoxybenzenesulfonamide is sourced from PubChem (CID 159036751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).