C26H27FN2O6S2 — CID 159036751
2-fluorobenzenesulfonamide;phenylmethanol;2-phenylmethoxybenzenesulfonamide (PubChem CID 159036751) has the molecular formula C26H27FN2O6S2 and a molecular weight of 546.64 g/mol. Its IUPAC name is 2-fluorobenzenesulfonamide;phenylmethanol;2-phenylmethoxybenzenesulfonamide.
| Compound Name | 2-fluorobenzenesulfonamide;phenylmethanol;2-phenylmethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 159036751 |
| Molecular Formula | C26H27FN2O6S2 |
| Molecular Weight | 546.64 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | 2-fluorobenzenesulfonamide;phenylmethanol;2-phenylmethoxybenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1F.NS(=O)(=O)c1ccccc1OCc1ccccc1.OCc1ccccc1 |
| InChI | InChI=1S/C13H13NO3S.C7H8O.C6H6FNO2S/c14-18(15,16)13-9-5-4-8-12(13)17-10-11-6-2-1-3-7-11;8-6-7-4-2-1-3-5-7;7-5-3-1-2-4-6(5)11(8,9)10/h1-9H,10H2,(H2,14,15,16);1-5,8H,6H2;1-4H,(H2,8,9,10) |
| InChIKey | JVNYZEODCHFOCD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 149.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.64 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |