C20H26F2N4 — CID 159037937
6-fluoro-3-[1-[[1-(2-fluoroethyl)piperidin-4-yl]methyl]pyrazol-4-yl]-1H-indole;methane (PubChem CID 159037937) has the molecular formula C20H26F2N4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 6-fluoro-3-[1-[[1-(2-fluoroethyl)piperidin-4-yl]methyl]pyrazol-4-yl]-1H-indole;methane.
| Compound Name | 6-fluoro-3-[1-[[1-(2-fluoroethyl)piperidin-4-yl]methyl]pyrazol-4-yl]-1H-indole;methane |
|---|---|
| PubChem CID | 159037937 |
| Molecular Formula | C20H26F2N4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 6-fluoro-3-[1-[[1-(2-fluoroethyl)piperidin-4-yl]methyl]pyrazol-4-yl]-1H-indole;methane |
| SMILES | C.FCCN1CCC(Cn2cc(-c3c[nH]c4cc(F)ccc34)cn2)CC1 |
| InChI | InChI=1S/C19H22F2N4.CH4/c20-5-8-24-6-3-14(4-7-24)12-25-13-15(10-23-25)18-11-22-19-9-16(21)1-2-17(18)19;/h1-2,9-11,13-14,22H,3-8,12H2;1H4 |
| InChIKey | JVRLWDBPDKHCSC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |