C16H20FN3 — CID 161404196
3-(1-butylpyrazol-4-yl)-6-fluoro-1H-indole;methane (PubChem CID 161404196) has the molecular formula C16H20FN3 and a molecular weight of 273.36 g/mol. Its IUPAC name is 3-(1-butylpyrazol-4-yl)-6-fluoro-1H-indole;methane.
| Compound Name | 3-(1-butylpyrazol-4-yl)-6-fluoro-1H-indole;methane |
|---|---|
| PubChem CID | 161404196 |
| Molecular Formula | C16H20FN3 |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 3-(1-butylpyrazol-4-yl)-6-fluoro-1H-indole;methane |
| SMILES | C.CCCCn1cc(-c2c[nH]c3cc(F)ccc23)cn1 |
| InChI | InChI=1S/C15H16FN3.CH4/c1-2-3-6-19-10-11(8-18-19)14-9-17-15-7-12(16)4-5-13(14)15;/h4-5,7-10,17H,2-3,6H2,1H3;1H4 |
| InChIKey | VUPVTTQOPVKTBZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |