C11H16F6 — CID 159041673
1,2,3-trimethyl-1,3-bis(trifluoromethyl)cyclohexane (PubChem CID 159041673) has the molecular formula C11H16F6 and a molecular weight of 262.24 g/mol. Its IUPAC name is 1,2,3-trimethyl-1,3-bis(trifluoromethyl)cyclohexane.
| Compound Name | 1,2,3-trimethyl-1,3-bis(trifluoromethyl)cyclohexane |
|---|---|
| PubChem CID | 159041673 |
| Molecular Formula | C11H16F6 |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1,2,3-trimethyl-1,3-bis(trifluoromethyl)cyclohexane |
| SMILES | CC1C(C)(C(F)(F)F)CCCC1(C)C(F)(F)F |
| InChI | InChI=1S/C11H16F6/c1-7-8(2,10(12,13)14)5-4-6-9(7,3)11(15,16)17/h7H,4-6H2,1-3H3 |
| InChIKey | VWKBUYGRFCPGRH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |