C29H38N2O10 — CID 159053286
[2-[(2-carbamoyloxyphenyl)methyl]phenyl] carbamate;bis(6-hydroxy-2-methylidenehexanoic acid) (PubChem CID 159053286) has the molecular formula C29H38N2O10 and a molecular weight of 574.63 g/mol. Its IUPAC name is [2-[(2-carbamoyloxyphenyl)methyl]phenyl] carbamate;bis(6-hydroxy-2-methylidenehexanoic acid).
| Compound Name | [2-[(2-carbamoyloxyphenyl)methyl]phenyl] carbamate;bis(6-hydroxy-2-methylidenehexanoic acid) |
|---|---|
| PubChem CID | 159053286 |
| Molecular Formula | C29H38N2O10 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | [2-[(2-carbamoyloxyphenyl)methyl]phenyl] carbamate;bis(6-hydroxy-2-methylidenehexanoic acid) |
| SMILES | C=C(CCCCO)C(=O)O.C=C(CCCCO)C(=O)O.NC(=O)Oc1ccccc1Cc1ccccc1OC(N)=O |
| InChI | InChI=1S/C15H14N2O4.2C7H12O3/c16-14(18)20-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)21-15(17)19;2*1-6(7(9)10)4-2-3-5-8/h1-8H,9H2,(H2,16,18)(H2,17,19);2*8H,1-5H2,(H,9,10) |
| InChIKey | JXNUMEHSNJGZIS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 219.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|