About bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);(2-carbamoyloxyphenyl) carbamate
bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);(2-carbamoyloxyphenyl) carbamate (PubChem CID 175859022) has the molecular formula C16H30N4O10
and a molecular weight of 438.43 g/mol. Its IUPAC name is bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);(2-carbamoyloxyphenyl) carbamate.
Molecular Properties
| Compound Name | bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);(2-carbamoyloxyphenyl) carbamate |
| PubChem CID | 175859022 |
| Molecular Formula | C16H30N4O10 |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);(2-carbamoyloxyphenyl) carbamate |
| SMILES | NC(=O)Oc1ccccc1OC(N)=O.NC(CO)(CO)CO.NC(CO)(CO)CO |
| InChI | InChI=1S/C8H8N2O4.2C4H11NO3/c9-7(11)13-5-3-1-2-4-6(5)14-8(10)12;2*5-4(1-6,2-7)3-8/h1-4H,(H2,9,11)(H2,10,12);2*6-8H,1-3,5H2 |
| InChIKey | RGGMAOAGBVKZEU-UHFFFAOYSA-N |
| XLogP | -4.08 |
| TPSA | 278.06 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
Analyze bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);(2-carbamoyloxyphenyl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);(2-carbamoyloxyphenyl) carbamate?
The IUPAC name of bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);(2-carbamoyloxyphenyl) carbamate (CID 175859022) is bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);(2-carbamoyloxyphenyl) carbamate.
What is the SMILES notation for bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);(2-carbamoyloxyphenyl) carbamate?
The canonical SMILES for bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);(2-carbamoyloxyphenyl) carbamate is NC(=O)Oc1ccccc1OC(N)=O.NC(CO)(CO)CO.NC(CO)(CO)CO.
What is the InChIKey of bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);(2-carbamoyloxyphenyl) carbamate?
The InChIKey is RGGMAOAGBVKZEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O4.2C4H11NO3/c9-7(11)13-5-3-1-2-4-6(5)14-8(10)12;2*5-4(1-6,2-7)3-8/h1-4H,(H2,9,11)(H2,10,12);2*6-8H,1-3,5H2.
What are the key properties of bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);(2-carbamoyloxyphenyl) carbamate?
bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);(2-carbamoyloxyphenyl) carbamate has a molecular weight of 438.43 g/mol, XLogP of -4.08, 8 rotatable bonds, 10 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);(2-carbamoyloxyphenyl) carbamate is sourced from PubChem (CID 175859022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).