About (2-trimethylsilylphenyl) carbamate
(2-trimethylsilylphenyl) carbamate (PubChem CID 68854003) has the molecular formula C10H15NO2Si
and a molecular weight of 209.32 g/mol. Its IUPAC name is (2-trimethylsilylphenyl) carbamate.
Molecular Properties
| Compound Name | (2-trimethylsilylphenyl) carbamate |
| PubChem CID | 68854003 |
| Molecular Formula | C10H15NO2Si |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | (2-trimethylsilylphenyl) carbamate |
| SMILES | C[Si](C)(C)c1ccccc1OC(N)=O |
| InChI | InChI=1S/C10H15NO2Si/c1-14(2,3)9-7-5-4-6-8(9)13-10(11)12/h4-7H,1-3H3,(H2,11,12) |
| InChIKey | VSGVXHAYISXJMR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-trimethylsilylphenyl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-trimethylsilylphenyl) carbamate?
The IUPAC name of (2-trimethylsilylphenyl) carbamate (CID 68854003) is (2-trimethylsilylphenyl) carbamate.
What is the SMILES notation for (2-trimethylsilylphenyl) carbamate?
The canonical SMILES for (2-trimethylsilylphenyl) carbamate is C[Si](C)(C)c1ccccc1OC(N)=O.
What is the InChIKey of (2-trimethylsilylphenyl) carbamate?
The InChIKey is VSGVXHAYISXJMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2Si/c1-14(2,3)9-7-5-4-6-8(9)13-10(11)12/h4-7H,1-3H3,(H2,11,12).
What are the key properties of (2-trimethylsilylphenyl) carbamate?
(2-trimethylsilylphenyl) carbamate has a molecular weight of 209.32 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-trimethylsilylphenyl) carbamate is sourced from PubChem (CID 68854003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).