About (2-trimethylsilylphenyl) acetate
(2-trimethylsilylphenyl) acetate (PubChem CID 13101762) has the molecular formula C11H16O2Si
and a molecular weight of 208.33 g/mol. Its IUPAC name is (2-trimethylsilylphenyl) acetate.
Molecular Properties
| Compound Name | (2-trimethylsilylphenyl) acetate |
| PubChem CID | 13101762 |
| Molecular Formula | C11H16O2Si |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | (2-trimethylsilylphenyl) acetate |
| SMILES | CC(=O)Oc1ccccc1[Si](C)(C)C |
| InChI | InChI=1S/C11H16O2Si/c1-9(12)13-10-7-5-6-8-11(10)14(2,3)4/h5-8H,1-4H3 |
| InChIKey | HLVHPQOSDVCDOD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-trimethylsilylphenyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-trimethylsilylphenyl) acetate?
The IUPAC name of (2-trimethylsilylphenyl) acetate (CID 13101762) is (2-trimethylsilylphenyl) acetate.
What is the SMILES notation for (2-trimethylsilylphenyl) acetate?
The canonical SMILES for (2-trimethylsilylphenyl) acetate is CC(=O)Oc1ccccc1[Si](C)(C)C.
What is the InChIKey of (2-trimethylsilylphenyl) acetate?
The InChIKey is HLVHPQOSDVCDOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2Si/c1-9(12)13-10-7-5-6-8-11(10)14(2,3)4/h5-8H,1-4H3.
What are the key properties of (2-trimethylsilylphenyl) acetate?
(2-trimethylsilylphenyl) acetate has a molecular weight of 208.33 g/mol, XLogP of 2.16, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-trimethylsilylphenyl) acetate is sourced from PubChem (CID 13101762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).