C38H48O2 — CID 159053464
(4aS,5aS,12aS)-3,4a,5a,10,12,12a-hexamethyl-9-(4-methylphenyl)-7-propan-2-yl-2-prop-1-en-2-yl-5,6-dihydro-4H-tetracene-1,11-dione;methane (PubChem CID 159053464) has the molecular formula C38H48O2 and a molecular weight of 536.80 g/mol. Its IUPAC name is (4aS,5aS,12aS)-3,4a,5a,10,12,12a-hexamethyl-9-(4-methylphenyl)-7-propan-2-yl-2-prop-1-en-2-yl-5,6-dihydro-4H-tetracene-1,11-dione;methane.
| Compound Name | (4aS,5aS,12aS)-3,4a,5a,10,12,12a-hexamethyl-9-(4-methylphenyl)-7-propan-2-yl-2-prop-1-en-2-yl-5,6-dihydro-4H-tetracene-1,11-dione;methane |
|---|---|
| PubChem CID | 159053464 |
| Molecular Formula | C38H48O2 |
| Molecular Weight | 536.80 g/mol |
| Exact Mass | 536.37 |
| IUPAC Name | (4aS,5aS,12aS)-3,4a,5a,10,12,12a-hexamethyl-9-(4-methylphenyl)-7-propan-2-yl-2-prop-1-en-2-yl-5,6-dihydro-4H-tetracene-1,11-dione;methane |
| SMILES | C.C=C(C)C1=C(C)C[C@@]2(C)C[C@@]3(C)Cc4c(C(C)C)cc(-c5ccc(C)cc5)c(C)c4C(=O)C3=C(C)[C@@]2(C)C1=O |
| InChI | InChI=1S/C37H44O2.CH4/c1-20(2)27-16-28(26-14-12-22(5)13-15-26)24(7)31-29(27)18-35(9)19-36(10)17-23(6)30(21(3)4)34(39)37(36,11)25(8)32(35)33(31)38;/h12-16,20H,3,17-19H2,1-2,4-11H3;1H4/t35-,36+,37+;/m1./s1 |
| InChIKey | JXOLHPJQVRZCSI-XOGBDPNQSA-N |
| XLogP | 10.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.80 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |