C25H29N7O2 — CID 159056001
trans-(1S,2S)-2-(2-acetamidoethyl)-N-[8-amino-6-(4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)-2,7-naphthyridin-3-yl]cyclopropane-1-carboxamide (PubChem CID 159056001) has the molecular formula C25H29N7O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is trans-(1S,2S)-2-(2-acetamidoethyl)-N-[8-amino-6-(4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)-2,7-naphthyridin-3-yl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-2-(2-acetamidoethyl)-N-[8-amino-6-(4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)-2,7-naphthyridin-3-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 159056001 |
| Molecular Formula | C25H29N7O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | trans-(1S,2S)-2-(2-acetamidoethyl)-N-[8-amino-6-(4-methyl-5,6,7,8-tetrahydro-1,5-naphthyridin-3-yl)-2,7-naphthyridin-3-yl]cyclopropane-1-carboxamide |
| SMILES | CC(=O)NCC[C@@H]1C[C@@H]1C(=O)Nc1cc2cc(-c3cnc4c(c3C)NCCC4)nc(N)c2cn1 |
| InChI | InChI=1S/C25H29N7O2/c1-13-18(11-29-20-4-3-6-28-23(13)20)21-9-16-10-22(30-12-19(16)24(26)31-21)32-25(34)17-8-15(17)5-7-27-14(2)33/h9-12,15,17,28H,3-8H2,1-2H3,(H2,26,31)(H,27,33)(H,30,32,34)/t15-,17+/m1/s1 |
| InChIKey | OFAVOZOKEWESST-WBVHZDCISA-N |
| XLogP | 3.04 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |