C18H16N7NaO6S2 — CID 159061417
sodium (6R)-7-[[2-hydroxyimino-2-(4-hydroxyphenyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 159061417) has the molecular formula C18H16N7NaO6S2 and a molecular weight of 513.49 g/mol. Its IUPAC name is sodium (6R)-7-[[2-hydroxyimino-2-(4-hydroxyphenyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | sodium (6R)-7-[[2-hydroxyimino-2-(4-hydroxyphenyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 159061417 |
| Molecular Formula | C18H16N7NaO6S2 |
| Molecular Weight | 513.49 g/mol |
| Exact Mass | 513.05 |
| IUPAC Name | sodium (6R)-7-[[2-hydroxyimino-2-(4-hydroxyphenyl)acetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | Cn1nnnc1SCC1=C(C(=O)[O-])N2C(=O)C(NC(=O)C(=NO)c3ccc(O)cc3)[C@H]2SC1.[Na+] |
| InChI | InChI=1S/C18H17N7O6S2.Na/c1-24-18(20-22-23-24)33-7-9-6-32-16-12(15(28)25(16)13(9)17(29)30)19-14(27)11(21-31)8-2-4-10(26)5-3-8;/h2-5,12,16,26,31H,6-7H2,1H3,(H,19,27)(H,29,30);/q;+1/p-1/t12?,16-;/m1./s1 |
| InChIKey | JYNAFGDASRGFNT-LWPABBACSA-M |
| XLogP | -4.71 |
| TPSA | 185.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.49 |
| LogP ≤ 5 | -4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|