C17H15N8NaO5S2 — CID 88717369
sodium (6S,7R)-3-[(1-aminotetrazol-5-yl)sulfanylmethyl]-7-[[(2Z)-2-hydroxyimino-2-phenylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88717369) has the molecular formula C17H15N8NaO5S2 and a molecular weight of 498.48 g/mol. Its IUPAC name is sodium (6S,7R)-3-[(1-aminotetrazol-5-yl)sulfanylmethyl]-7-[[(2Z)-2-hydroxyimino-2-phenylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | sodium (6S,7R)-3-[(1-aminotetrazol-5-yl)sulfanylmethyl]-7-[[(2Z)-2-hydroxyimino-2-phenylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88717369 |
| Molecular Formula | C17H15N8NaO5S2 |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | sodium (6S,7R)-3-[(1-aminotetrazol-5-yl)sulfanylmethyl]-7-[[(2Z)-2-hydroxyimino-2-phenylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | Nn1nnnc1SCC1=C(C(=O)[O-])N2C(=O)[C@@H](NC(=O)/C(=N\O)c3ccccc3)[C@@H]2SC1.[Na+] |
| InChI | InChI=1S/C17H16N8O5S2.Na/c18-25-17(20-22-23-25)32-7-9-6-31-15-11(14(27)24(15)12(9)16(28)29)19-13(26)10(21-30)8-4-2-1-3-5-8;/h1-5,11,15,30H,6-7,18H2,(H,19,26)(H,28,29);/q;+1/p-1/b21-10-;/t11-,15+;/m1./s1 |
| InChIKey | NTKCHIOARRSDFT-ITWYUFLTSA-M |
| XLogP | -5.23 |
| TPSA | 191.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | -5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|