C19H19N7O8S3 — CID 88807281
(6R,7R)-7-[[(2E)-2-methoxyimino-2-phenylacetyl]amino]-8-oxo-3-[[1-(sulfomethyl)tetrazol-5-yl]sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88807281) has the molecular formula C19H19N7O8S3 and a molecular weight of 569.60 g/mol. Its IUPAC name is (6R,7R)-7-[[(2E)-2-methoxyimino-2-phenylacetyl]amino]-8-oxo-3-[[1-(sulfomethyl)tetrazol-5-yl]sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-[[(2E)-2-methoxyimino-2-phenylacetyl]amino]-8-oxo-3-[[1-(sulfomethyl)tetrazol-5-yl]sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88807281 |
| Molecular Formula | C19H19N7O8S3 |
| Molecular Weight | 569.60 g/mol |
| Exact Mass | 569.05 |
| IUPAC Name | (6R,7R)-7-[[(2E)-2-methoxyimino-2-phenylacetyl]amino]-8-oxo-3-[[1-(sulfomethyl)tetrazol-5-yl]sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO/N=C(/C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(CSc3nnnn3CS(=O)(=O)O)CS[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C19H19N7O8S3/c1-34-22-12(10-5-3-2-4-6-10)15(27)20-13-16(28)26-14(18(29)30)11(7-35-17(13)26)8-36-19-21-23-24-25(19)9-37(31,32)33/h2-6,13,17H,7-9H2,1H3,(H,20,27)(H,29,30)(H,31,32,33)/b22-12+/t13-,17-/m1/s1 |
| InChIKey | KOVHIHNJBXQRQV-JLEKKXMWSA-N |
| XLogP | -0.60 |
| TPSA | 206.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.60 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|