C15H11N7O6S4 — CID 54216945
(6S)-7-[(1-cyanocycloprop-2-yne-1-carbothioyl)amino]-8-oxo-3-[[1-(sulfomethyl)tetrazol-5-yl]sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54216945) has the molecular formula C15H11N7O6S4 and a molecular weight of 513.56 g/mol. Its IUPAC name is (6S)-7-[(1-cyanocycloprop-2-yne-1-carbothioyl)amino]-8-oxo-3-[[1-(sulfomethyl)tetrazol-5-yl]sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[(1-cyanocycloprop-2-yne-1-carbothioyl)amino]-8-oxo-3-[[1-(sulfomethyl)tetrazol-5-yl]sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54216945 |
| Molecular Formula | C15H11N7O6S4 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 512.97 |
| IUPAC Name | (6S)-7-[(1-cyanocycloprop-2-yne-1-carbothioyl)amino]-8-oxo-3-[[1-(sulfomethyl)tetrazol-5-yl]sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | N#CC1(C(=S)NC2C(=O)N3C(C(=O)O)=C(CSc4nnnn4CS(=O)(=O)O)CS[C@@H]23)C#C1 |
| InChI | InChI=1S/C15H11N7O6S4/c16-5-15(1-2-15)13(29)17-8-10(23)22-9(12(24)25)7(3-30-11(8)22)4-31-14-18-19-20-21(14)6-32(26,27)28/h8,11H,3-4,6H2,(H,17,29)(H,24,25)(H,26,27,28)/t8?,11-/m0/s1 |
| InChIKey | PZVQUFLLIHUPCF-LYNSQETBSA-N |
| XLogP | -1.32 |
| TPSA | 191.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|