C15H13N7O4S3 — CID 54388356
(6S)-7-[(1-formamidocycloprop-2-yne-1-carbothioyl)amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54388356) has the molecular formula C15H13N7O4S3 and a molecular weight of 451.52 g/mol. Its IUPAC name is (6S)-7-[(1-formamidocycloprop-2-yne-1-carbothioyl)amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[(1-formamidocycloprop-2-yne-1-carbothioyl)amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54388356 |
| Molecular Formula | C15H13N7O4S3 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | (6S)-7-[(1-formamidocycloprop-2-yne-1-carbothioyl)amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | Cn1nnnc1SCC1=C(C(=O)O)N2C(=O)C(NC(=S)C3(NC=O)C#C3)[C@@H]2SC1 |
| InChI | InChI=1S/C15H13N7O4S3/c1-21-14(18-19-20-21)29-5-7-4-28-11-8(10(24)22(11)9(7)12(25)26)17-13(27)15(2-3-15)16-6-23/h6,8,11H,4-5H2,1H3,(H,16,23)(H,17,27)(H,25,26)/t8?,11-/m0/s1 |
| InChIKey | VEVXPATUHSZNDK-LYNSQETBSA-N |
| XLogP | -1.66 |
| TPSA | 142.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|