C9H21O5P — CID 159062871
2-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methoxy]ethanol;methane (PubChem CID 159062871) has the molecular formula C9H21O5P and a molecular weight of 240.24 g/mol. Its IUPAC name is 2-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methoxy]ethanol;methane.
| Compound Name | 2-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methoxy]ethanol;methane |
|---|---|
| PubChem CID | 159062871 |
| Molecular Formula | C9H21O5P |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-[(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methoxy]ethanol;methane |
| SMILES | C.CC1(C)COP(=O)(COCCO)OC1 |
| InChI | InChI=1S/C8H17O5P.CH4/c1-8(2)5-12-14(10,13-6-8)7-11-4-3-9;/h9H,3-7H2,1-2H3;1H4 |
| InChIKey | JYRQDIMEEXQFKD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|