About 1-methoxy-2,2-bis(methoxymethyl)butane;3-(prop-2-enoxymethyl)but-3-en-2-one
1-methoxy-2,2-bis(methoxymethyl)butane;3-(prop-2-enoxymethyl)but-3-en-2-one (PubChem CID 159063156) has the molecular formula C17H32O5
and a molecular weight of 316.44 g/mol. Its IUPAC name is 1-methoxy-2,2-bis(methoxymethyl)butane;3-(prop-2-enoxymethyl)but-3-en-2-one.
Molecular Properties
| Compound Name | 1-methoxy-2,2-bis(methoxymethyl)butane;3-(prop-2-enoxymethyl)but-3-en-2-one |
| PubChem CID | 159063156 |
| Molecular Formula | C17H32O5 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 1-methoxy-2,2-bis(methoxymethyl)butane;3-(prop-2-enoxymethyl)but-3-en-2-one |
| SMILES | C=CCOCC(=C)C(C)=O.CCC(COC)(COC)COC |
| InChI | InChI=1S/C9H20O3.C8H12O2/c1-5-9(6-10-2,7-11-3)8-12-4;1-4-5-10-6-7(2)8(3)9/h5-8H2,1-4H3;4H,1-2,5-6H2,3H3 |
| InChIKey | JYSLVITUEQYKMX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-2,2-bis(methoxymethyl)butane;3-(prop-2-enoxymethyl)but-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2,2-bis(methoxymethyl)butane;3-(prop-2-enoxymethyl)but-3-en-2-one?
The IUPAC name of 1-methoxy-2,2-bis(methoxymethyl)butane;3-(prop-2-enoxymethyl)but-3-en-2-one (CID 159063156) is 1-methoxy-2,2-bis(methoxymethyl)butane;3-(prop-2-enoxymethyl)but-3-en-2-one.
What is the SMILES notation for 1-methoxy-2,2-bis(methoxymethyl)butane;3-(prop-2-enoxymethyl)but-3-en-2-one?
The canonical SMILES for 1-methoxy-2,2-bis(methoxymethyl)butane;3-(prop-2-enoxymethyl)but-3-en-2-one is C=CCOCC(=C)C(C)=O.CCC(COC)(COC)COC.
What is the InChIKey of 1-methoxy-2,2-bis(methoxymethyl)butane;3-(prop-2-enoxymethyl)but-3-en-2-one?
The InChIKey is JYSLVITUEQYKMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O3.C8H12O2/c1-5-9(6-10-2,7-11-3)8-12-4;1-4-5-10-6-7(2)8(3)9/h5-8H2,1-4H3;4H,1-2,5-6H2,3H3.
What are the key properties of 1-methoxy-2,2-bis(methoxymethyl)butane;3-(prop-2-enoxymethyl)but-3-en-2-one?
1-methoxy-2,2-bis(methoxymethyl)butane;3-(prop-2-enoxymethyl)but-3-en-2-one has a molecular weight of 316.44 g/mol, XLogP of 2.66, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2,2-bis(methoxymethyl)butane;3-(prop-2-enoxymethyl)but-3-en-2-one is sourced from PubChem (CID 159063156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).