C15H28O4 — CID 160967466
1,3-dimethoxy-2,2-dimethylpropane;3-(prop-2-enoxymethyl)but-3-en-2-one (PubChem CID 160967466) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is 1,3-dimethoxy-2,2-dimethylpropane;3-(prop-2-enoxymethyl)but-3-en-2-one.
| Compound Name | 1,3-dimethoxy-2,2-dimethylpropane;3-(prop-2-enoxymethyl)but-3-en-2-one |
|---|---|
| PubChem CID | 160967466 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 1,3-dimethoxy-2,2-dimethylpropane;3-(prop-2-enoxymethyl)but-3-en-2-one |
| SMILES | C=CCOCC(=C)C(C)=O.COCC(C)(C)COC |
| InChI | InChI=1S/C8H12O2.C7H16O2/c1-4-5-10-6-7(2)8(3)9;1-7(2,5-8-3)6-9-4/h4H,1-2,5-6H2,3H3;5-6H2,1-4H3 |
| InChIKey | SXUVMQFMWYFKKT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|