C20H12F2IN3O3 — CID 159064002
(5S)-5-[2-(2-fluoro-4-iodophenyl)ethynyl]-5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 159064002) has the molecular formula C20H12F2IN3O3 and a molecular weight of 507.23 g/mol. Its IUPAC name is (5S)-5-[2-(2-fluoro-4-iodophenyl)ethynyl]-5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[2-(2-fluoro-4-iodophenyl)ethynyl]-5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 159064002 |
| Molecular Formula | C20H12F2IN3O3 |
| Molecular Weight | 507.23 g/mol |
| Exact Mass | 506.99 |
| IUPAC Name | (5S)-5-[2-(2-fluoro-4-iodophenyl)ethynyl]-5-[(5-fluoro-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@](C#Cc2ccc(I)cc2F)(CN2Cc3ccc(F)cc3C2=O)N1 |
| InChI | InChI=1S/C20H12F2IN3O3/c21-13-3-1-12-9-26(17(27)15(12)7-13)10-20(18(28)24-19(29)25-20)6-5-11-2-4-14(23)8-16(11)22/h1-4,7-8H,9-10H2,(H2,24,25,28,29)/t20-/m0/s1 |
| InChIKey | JYVCDUZLCIOJOT-FQEVSTJZSA-N |
| XLogP | 2.16 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|