C24H21N5O5 — CID 76671030
5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[4-(2-oxoimidazolidin-1-yl)phenyl]ethynyl]imidazolidine-2,4-dione (PubChem CID 76671030) has the molecular formula C24H21N5O5 and a molecular weight of 459.46 g/mol. Its IUPAC name is 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[4-(2-oxoimidazolidin-1-yl)phenyl]ethynyl]imidazolidine-2,4-dione.
| Compound Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[4-(2-oxoimidazolidin-1-yl)phenyl]ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 76671030 |
| Molecular Formula | C24H21N5O5 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[4-(2-oxoimidazolidin-1-yl)phenyl]ethynyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(CC1(C#Cc3ccc(N4CCNC4=O)cc3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C24H21N5O5/c1-34-18-7-4-16-13-28(20(30)19(16)12-18)14-24(21(31)26-22(32)27-24)9-8-15-2-5-17(6-3-15)29-11-10-25-23(29)33/h2-7,12H,10-11,13-14H2,1H3,(H,25,33)(H2,26,27,31,32) |
| InChIKey | DGFLUWCVPLUGKX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|