C27H25N5O5 — CID 90811465
5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[4-(4-oxopiperidine-1-carboximidoyl)phenyl]ethynyl]imidazolidine-2,4-dione (PubChem CID 90811465) has the molecular formula C27H25N5O5 and a molecular weight of 499.53 g/mol. Its IUPAC name is 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[4-(4-oxopiperidine-1-carboximidoyl)phenyl]ethynyl]imidazolidine-2,4-dione.
| Compound Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[4-(4-oxopiperidine-1-carboximidoyl)phenyl]ethynyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90811465 |
| Molecular Formula | C27H25N5O5 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-5-[2-[4-(4-oxopiperidine-1-carboximidoyl)phenyl]ethynyl]imidazolidine-2,4-dione |
| SMILES | [H]/N=C(/c1ccc(C#CC2(CN3Cc4ccc(OC)cc4C3=O)NC(=O)NC2=O)cc1)N1CCC(=O)CC1 |
| InChI | InChI=1S/C27H25N5O5/c1-37-21-7-6-19-15-32(24(34)22(19)14-21)16-27(25(35)29-26(36)30-27)11-8-17-2-4-18(5-3-17)23(28)31-12-9-20(33)10-13-31/h2-7,14,28H,9-10,12-13,15-16H2,1H3,(H2,29,30,35,36)/b28-23- |
| InChIKey | JOYNUVBACJNGNY-NFFVHWSESA-N |
| XLogP | 1.27 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|