C26H27N5O4 — CID 90788065
N,N-diethyl-4-[2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]benzenecarboximidamide (PubChem CID 90788065) has the molecular formula C26H27N5O4 and a molecular weight of 473.53 g/mol. Its IUPAC name is N,N-diethyl-4-[2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]benzenecarboximidamide.
| Compound Name | N,N-diethyl-4-[2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 90788065 |
| Molecular Formula | C26H27N5O4 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | N,N-diethyl-4-[2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]benzenecarboximidamide |
| SMILES | [H]/N=C(/c1ccc(C#CC2(CN3Cc4ccc(OC)cc4C3=O)NC(=O)NC2=O)cc1)N(CC)CC |
| InChI | InChI=1S/C26H27N5O4/c1-4-30(5-2)22(27)18-8-6-17(7-9-18)12-13-26(24(33)28-25(34)29-26)16-31-15-19-10-11-20(35-3)14-21(19)23(31)32/h6-11,14,27H,4-5,15-16H2,1-3H3,(H2,28,29,33,34)/b27-22- |
| InChIKey | YSWGIYRCJOILPT-QYQHSDTDSA-N |
| XLogP | 1.95 |
| TPSA | 114.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|