C29H34N6O5 — CID 75108216
N-[2-(diethylamino)ethyl]-N'-hydroxy-4-[2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]-N-methylbenzenecarboximidamide (PubChem CID 75108216) has the molecular formula C29H34N6O5 and a molecular weight of 546.63 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N'-hydroxy-4-[2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]-N-methylbenzenecarboximidamide.
| Compound Name | N-[2-(diethylamino)ethyl]-N'-hydroxy-4-[2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]-N-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 75108216 |
| Molecular Formula | C29H34N6O5 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N'-hydroxy-4-[2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]-N-methylbenzenecarboximidamide |
| SMILES | CCN(CC)CCN(C)C(=NO)c1ccc(C#CC2(CN3Cc4ccc(OC)cc4C3=O)NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C29H34N6O5/c1-5-34(6-2)16-15-33(3)25(32-39)21-9-7-20(8-10-21)13-14-29(27(37)30-28(38)31-29)19-35-18-22-11-12-23(40-4)17-24(22)26(35)36/h7-12,17,39H,5-6,15-16,18-19H2,1-4H3,(H2,30,31,37,38) |
| InChIKey | HITJOGCPGHLKNI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|