C27H28N4O5 — CID 161331776
N'-hydroxy-4-[2-[(3S)-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxopyrrolidin-3-yl]ethynyl]-N-methyl-N-propylbenzenecarboximidamide (PubChem CID 161331776) has the molecular formula C27H28N4O5 and a molecular weight of 488.54 g/mol. Its IUPAC name is N'-hydroxy-4-[2-[(3S)-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxopyrrolidin-3-yl]ethynyl]-N-methyl-N-propylbenzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[2-[(3S)-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxopyrrolidin-3-yl]ethynyl]-N-methyl-N-propylbenzenecarboximidamide |
|---|---|
| PubChem CID | 161331776 |
| Molecular Formula | C27H28N4O5 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | N'-hydroxy-4-[2-[(3S)-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxopyrrolidin-3-yl]ethynyl]-N-methyl-N-propylbenzenecarboximidamide |
| SMILES | CCCN(C)C(=NO)c1ccc(C#C[C@]2(CN3Cc4ccc(OC)cc4C3=O)CC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C27H28N4O5/c1-4-13-30(2)24(29-35)19-7-5-18(6-8-19)11-12-27(15-23(32)28-26(27)34)17-31-16-20-9-10-21(36-3)14-22(20)25(31)33/h5-10,14,35H,4,13,15-17H2,1-3H3,(H,28,32,34)/t27-/m1/s1 |
| InChIKey | FBPYEEVWVBESOM-HHHXNRCGSA-N |
| XLogP | 2.21 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|