C30H34N6O5 — CID 58041755
(5R)-5-[2-[4-[(Z)-N-hydroxy-C-(4-propan-2-yl-1,4-diazepan-1-yl)carbonimidoyl]phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 58041755) has the molecular formula C30H34N6O5 and a molecular weight of 558.64 g/mol. Its IUPAC name is (5R)-5-[2-[4-[(Z)-N-hydroxy-C-(4-propan-2-yl-1,4-diazepan-1-yl)carbonimidoyl]phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-[4-[(Z)-N-hydroxy-C-(4-propan-2-yl-1,4-diazepan-1-yl)carbonimidoyl]phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 58041755 |
| Molecular Formula | C30H34N6O5 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | (5R)-5-[2-[4-[(Z)-N-hydroxy-C-(4-propan-2-yl-1,4-diazepan-1-yl)carbonimidoyl]phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(C#Cc3ccc(/C(=N/O)N4CCCN(C(C)C)CC4)cc3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C30H34N6O5/c1-20(2)34-13-4-14-35(16-15-34)26(33-40)22-7-5-21(6-8-22)11-12-30(28(38)31-29(39)32-30)19-36-18-23-9-10-24(41-3)17-25(23)27(36)37/h5-10,17,20,40H,4,13-16,18-19H2,1-3H3,(H2,31,32,38,39)/b33-26-/t30-/m1/s1 |
| InChIKey | QNZRTJWRJTWXMA-OABVPOGTSA-N |
| XLogP | 1.83 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|