C27H28N6O5 — CID 88570089
(5R)-5-[2-[4-[(E)-N-hydroxy-C-[(2S)-2-methylpiperazin-1-yl]carbonimidoyl]phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 88570089) has the molecular formula C27H28N6O5 and a molecular weight of 516.56 g/mol. Its IUPAC name is (5R)-5-[2-[4-[(E)-N-hydroxy-C-[(2S)-2-methylpiperazin-1-yl]carbonimidoyl]phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-[4-[(E)-N-hydroxy-C-[(2S)-2-methylpiperazin-1-yl]carbonimidoyl]phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 88570089 |
| Molecular Formula | C27H28N6O5 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | (5R)-5-[2-[4-[(E)-N-hydroxy-C-[(2S)-2-methylpiperazin-1-yl]carbonimidoyl]phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(C#Cc3ccc(/C(=N\O)N4CCNC[C@@H]4C)cc3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C27H28N6O5/c1-17-14-28-11-12-33(17)23(31-37)19-5-3-18(4-6-19)9-10-27(25(35)29-26(36)30-27)16-32-15-20-7-8-21(38-2)13-22(20)24(32)34/h3-8,13,17,28,37H,11-12,14-16H2,1-2H3,(H2,29,30,35,36)/b31-23+/t17-,27+/m0/s1 |
| InChIKey | ITEYVAAVSASSKJ-VRNUXYGZSA-N |
| XLogP | 0.71 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|