C27H27N5O6 — CID 122196612
(5R)-5-[2-[4-[(E)-N-methoxy-C-morpholin-4-ylcarbonimidoyl]phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 122196612) has the molecular formula C27H27N5O6 and a molecular weight of 517.54 g/mol. Its IUPAC name is (5R)-5-[2-[4-[(E)-N-methoxy-C-morpholin-4-ylcarbonimidoyl]phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-[4-[(E)-N-methoxy-C-morpholin-4-ylcarbonimidoyl]phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 122196612 |
| Molecular Formula | C27H27N5O6 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | (5R)-5-[2-[4-[(E)-N-methoxy-C-morpholin-4-ylcarbonimidoyl]phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CO/N=C(\c1ccc(C#C[C@]2(CN3Cc4ccc(OC)cc4C3=O)NC(=O)NC2=O)cc1)N1CCOCC1 |
| InChI | InChI=1S/C27H27N5O6/c1-36-21-8-7-20-16-32(24(33)22(20)15-21)17-27(25(34)28-26(35)29-27)10-9-18-3-5-19(6-4-18)23(30-37-2)31-11-13-38-14-12-31/h3-8,15H,11-14,16-17H2,1-2H3,(H2,28,29,34,35)/b30-23+/t27-/m1/s1 |
| InChIKey | OXTWJLIPMPPOKM-XIYZBIRNSA-N |
| XLogP | 0.92 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|