C32H33N5O5 — CID 58053308
(3S)-3-[4-[4-[(E)-N-hydroxy-C-(4-methylpiperazin-1-yl)carbonimidoyl]phenyl]phenyl]-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione (PubChem CID 58053308) has the molecular formula C32H33N5O5 and a molecular weight of 567.65 g/mol. Its IUPAC name is (3S)-3-[4-[4-[(E)-N-hydroxy-C-(4-methylpiperazin-1-yl)carbonimidoyl]phenyl]phenyl]-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[4-[4-[(E)-N-hydroxy-C-(4-methylpiperazin-1-yl)carbonimidoyl]phenyl]phenyl]-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 58053308 |
| Molecular Formula | C32H33N5O5 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.25 |
| IUPAC Name | (3S)-3-[4-[4-[(E)-N-hydroxy-C-(4-methylpiperazin-1-yl)carbonimidoyl]phenyl]phenyl]-3-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(c3ccc(-c4ccc(/C(=N\O)N5CCN(C)CC5)cc4)cc3)CC(=O)NC1=O)C2 |
| InChI | InChI=1S/C32H33N5O5/c1-35-13-15-36(16-14-35)29(34-41)23-5-3-21(4-6-23)22-7-10-25(11-8-22)32(18-28(38)33-31(32)40)20-37-19-24-9-12-26(42-2)17-27(24)30(37)39/h3-12,17,41H,13-16,18-20H2,1-2H3,(H,33,38,40)/b34-29+/t32-/m1/s1 |
| InChIKey | AKOGVJRYWMTJNQ-BJEWIVHGSA-N |
| XLogP | 2.69 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|