C25H22N4O5 — CID 76671196
1-[4-[2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]phenyl]cyclopropane-1-carboxamide (PubChem CID 76671196) has the molecular formula C25H22N4O5 and a molecular weight of 458.47 g/mol. Its IUPAC name is 1-[4-[2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]phenyl]cyclopropane-1-carboxamide.
| Compound Name | 1-[4-[2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 76671196 |
| Molecular Formula | C25H22N4O5 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 1-[4-[2-[4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]phenyl]cyclopropane-1-carboxamide |
| SMILES | COc1ccc2c(c1)C(=O)N(CC1(C#Cc3ccc(C4(C(N)=O)CC4)cc3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C25H22N4O5/c1-34-18-7-4-16-13-29(20(30)19(16)12-18)14-25(22(32)27-23(33)28-25)9-8-15-2-5-17(6-3-15)24(10-11-24)21(26)31/h2-7,12H,10-11,13-14H2,1H3,(H2,26,31)(H2,27,28,32,33) |
| InChIKey | FLWYCQFWAYXXPS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|