C26H24N6O6S — CID 88570061
(5R)-5-[4-[2-[(4R)-4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]phenyl]-5-[(methylsulfanylamino)methyl]imidazolidine-2,4-dione (PubChem CID 88570061) has the molecular formula C26H24N6O6S and a molecular weight of 548.58 g/mol. Its IUPAC name is (5R)-5-[4-[2-[(4R)-4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]phenyl]-5-[(methylsulfanylamino)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[4-[2-[(4R)-4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]phenyl]-5-[(methylsulfanylamino)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 88570061 |
| Molecular Formula | C26H24N6O6S |
| Molecular Weight | 548.58 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | (5R)-5-[4-[2-[(4R)-4-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]-2,5-dioxoimidazolidin-4-yl]ethynyl]phenyl]-5-[(methylsulfanylamino)methyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(C[C@@]1(C#Cc3ccc([C@]4(CNSC)NC(=O)NC4=O)cc3)NC(=O)NC1=O)C2 |
| InChI | InChI=1S/C26H24N6O6S/c1-38-18-8-5-16-12-32(20(33)19(16)11-18)14-25(21(34)28-23(36)30-25)10-9-15-3-6-17(7-4-15)26(13-27-39-2)22(35)29-24(37)31-26/h3-8,11,27H,12-14H2,1-2H3,(H2,28,30,34,36)(H2,29,31,35,37)/t25-,26+/m1/s1 |
| InChIKey | IKLGDNHZDWRROF-FTJBHMTQSA-N |
| XLogP | 0.18 |
| TPSA | 157.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.58 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|