C29H33N5O5 — CID 76671056
5-[2-[4-[1-(4-ethylpiperazin-1-yl)-2-hydroxyethyl]phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 76671056) has the molecular formula C29H33N5O5 and a molecular weight of 531.61 g/mol. Its IUPAC name is 5-[2-[4-[1-(4-ethylpiperazin-1-yl)-2-hydroxyethyl]phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[2-[4-[1-(4-ethylpiperazin-1-yl)-2-hydroxyethyl]phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 76671056 |
| Molecular Formula | C29H33N5O5 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | 5-[2-[4-[1-(4-ethylpiperazin-1-yl)-2-hydroxyethyl]phenyl]ethynyl]-5-[(5-methoxy-3-oxo-1H-isoindol-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CCN1CCN(C(CO)c2ccc(C#CC3(CN4Cc5ccc(OC)cc5C4=O)NC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C29H33N5O5/c1-3-32-12-14-33(15-13-32)25(18-35)21-6-4-20(5-7-21)10-11-29(27(37)30-28(38)31-29)19-34-17-22-8-9-23(39-2)16-24(22)26(34)36/h4-9,16,25,35H,3,12-15,17-19H2,1-2H3,(H2,30,31,37,38) |
| InChIKey | ANMLNJVXFBSDMU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|