C14H25NOS — CID 15906523
(1R,2R,4S)-1-methyl-4-prop-1-en-2-yl-2-thiomorpholin-4-ylcyclohexan-1-ol (PubChem CID 15906523) has the molecular formula C14H25NOS and a molecular weight of 255.43 g/mol. Its IUPAC name is (1R,2R,4S)-1-methyl-4-prop-1-en-2-yl-2-thiomorpholin-4-ylcyclohexan-1-ol.
| Compound Name | (1R,2R,4S)-1-methyl-4-prop-1-en-2-yl-2-thiomorpholin-4-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 15906523 |
| Molecular Formula | C14H25NOS |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | (1R,2R,4S)-1-methyl-4-prop-1-en-2-yl-2-thiomorpholin-4-ylcyclohexan-1-ol |
| SMILES | C=C(C)[C@H]1CC[C@@](C)(O)[C@H](N2CCSCC2)C1 |
| InChI | InChI=1S/C14H25NOS/c1-11(2)12-4-5-14(3,16)13(10-12)15-6-8-17-9-7-15/h12-13,16H,1,4-10H2,2-3H3/t12-,13+,14+/m0/s1 |
| InChIKey | FLNVMXBLSHSGAM-BFHYXJOUSA-N |
| XLogP | 2.53 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|